C15H16BrNO2S2 — CID 94080774
(2S)-1-(5-bromothiophen-2-yl)sulfonyl-2-(3-methylphenyl)pyrrolidine (PubChem CID 94080774) has the molecular formula C15H16BrNO2S2 and a molecular weight of 386.34 g/mol. Its IUPAC name is (2S)-1-(5-bromothiophen-2-yl)sulfonyl-2-(3-methylphenyl)pyrrolidine.
| Compound Name | (2S)-1-(5-bromothiophen-2-yl)sulfonyl-2-(3-methylphenyl)pyrrolidine |
|---|---|
| PubChem CID | 94080774 |
| Molecular Formula | C15H16BrNO2S2 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 384.98 |
| IUPAC Name | (2S)-1-(5-bromothiophen-2-yl)sulfonyl-2-(3-methylphenyl)pyrrolidine |
| SMILES | Cc1cccc([C@@H]2CCCN2S(=O)(=O)c2ccc(Br)s2)c1 |
| InChI | InChI=1S/C15H16BrNO2S2/c1-11-4-2-5-12(10-11)13-6-3-9-17(13)21(18,19)15-8-7-14(16)20-15/h2,4-5,7-8,10,13H,3,6,9H2,1H3/t13-/m0/s1 |
| InChIKey | IHXNDMYWMFVCQB-ZDUSSCGKSA-N |
| XLogP | 4.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |