C14H13Br2NO2S2 — CID 63422446
2-(3-bromophenyl)-1-(5-bromothiophen-2-yl)sulfonylpyrrolidine (PubChem CID 63422446) has the molecular formula C14H13Br2NO2S2 and a molecular weight of 451.21 g/mol. Its IUPAC name is 2-(3-bromophenyl)-1-(5-bromothiophen-2-yl)sulfonylpyrrolidine.
| Compound Name | 2-(3-bromophenyl)-1-(5-bromothiophen-2-yl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 63422446 |
| Molecular Formula | C14H13Br2NO2S2 |
| Molecular Weight | 451.21 g/mol |
| Exact Mass | 448.88 |
| IUPAC Name | 2-(3-bromophenyl)-1-(5-bromothiophen-2-yl)sulfonylpyrrolidine |
| SMILES | O=S(=O)(c1ccc(Br)s1)N1CCCC1c1cccc(Br)c1 |
| InChI | InChI=1S/C14H13Br2NO2S2/c15-11-4-1-3-10(9-11)12-5-2-8-17(12)21(18,19)14-7-6-13(16)20-14/h1,3-4,6-7,9,12H,2,5,8H2 |
| InChIKey | HKPBWAFOYDZWFN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.21 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |