C17H18N4O3 — CID 120863100
3-[[4-[3-(1-aminocyclobutyl)-1,2,4-oxadiazol-5-yl]phenyl]methyl]pyrrolidine-2,5-dione (PubChem CID 120863100) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 3-[[4-[3-(1-aminocyclobutyl)-1,2,4-oxadiazol-5-yl]phenyl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 3-[[4-[3-(1-aminocyclobutyl)-1,2,4-oxadiazol-5-yl]phenyl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 120863100 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 3-[[4-[3-(1-aminocyclobutyl)-1,2,4-oxadiazol-5-yl]phenyl]methyl]pyrrolidine-2,5-dione |
| SMILES | NC1(c2noc(-c3ccc(CC4CC(=O)NC4=O)cc3)n2)CCC1 |
| InChI | InChI=1S/C17H18N4O3/c18-17(6-1-7-17)16-20-15(24-21-16)11-4-2-10(3-5-11)8-12-9-13(22)19-14(12)23/h2-5,12H,1,6-9,18H2,(H,19,22,23) |
| InChIKey | KLQNXANJOLOGQN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|