C15H21ClN6O4 — CID 120867059
1-[[3-[2-(methylamino)propyl]-1,2,4-oxadiazol-5-yl]methyl]-3-[(4-nitrophenyl)methyl]urea;hydrochloride (PubChem CID 120867059) has the molecular formula C15H21ClN6O4 and a molecular weight of 384.82 g/mol. Its IUPAC name is 1-[[3-[2-(methylamino)propyl]-1,2,4-oxadiazol-5-yl]methyl]-3-[(4-nitrophenyl)methyl]urea;hydrochloride.
| Compound Name | 1-[[3-[2-(methylamino)propyl]-1,2,4-oxadiazol-5-yl]methyl]-3-[(4-nitrophenyl)methyl]urea;hydrochloride |
|---|---|
| PubChem CID | 120867059 |
| Molecular Formula | C15H21ClN6O4 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-[[3-[2-(methylamino)propyl]-1,2,4-oxadiazol-5-yl]methyl]-3-[(4-nitrophenyl)methyl]urea;hydrochloride |
| SMILES | CNC(C)Cc1noc(CNC(=O)NCc2ccc([N+](=O)[O-])cc2)n1.Cl |
| InChI | InChI=1S/C15H20N6O4.ClH/c1-10(16-2)7-13-19-14(25-20-13)9-18-15(22)17-8-11-3-5-12(6-4-11)21(23)24;/h3-6,10,16H,7-9H2,1-2H3,(H2,17,18,22);1H |
| InChIKey | CKONUQTVRPMEIN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|