C14H16F2N4O5 — CID 120868762
1-[5-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-1,2,4-oxadiazol-3-yl]-N-methylpropan-2-amine (PubChem CID 120868762) has the molecular formula C14H16F2N4O5 and a molecular weight of 358.30 g/mol. Its IUPAC name is 1-[5-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-1,2,4-oxadiazol-3-yl]-N-methylpropan-2-amine.
| Compound Name | 1-[5-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-1,2,4-oxadiazol-3-yl]-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 120868762 |
| Molecular Formula | C14H16F2N4O5 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 1-[5-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-1,2,4-oxadiazol-3-yl]-N-methylpropan-2-amine |
| SMILES | CNC(C)Cc1noc(-c2cc(OC)c(OC(F)F)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C14H16F2N4O5/c1-7(17-2)4-12-18-13(25-19-12)8-5-10(23-3)11(24-14(15)16)6-9(8)20(21)22/h5-7,14,17H,4H2,1-3H3 |
| InChIKey | VYZDGMWPBPCBCS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|