C10H20ClN5O2S — CID 120876257
3-methyl-N-[(3-methylpiperidin-3-yl)methyl]triazole-4-sulfonamide;hydrochloride (PubChem CID 120876257) has the molecular formula C10H20ClN5O2S and a molecular weight of 309.82 g/mol. Its IUPAC name is 3-methyl-N-[(3-methylpiperidin-3-yl)methyl]triazole-4-sulfonamide;hydrochloride.
| Compound Name | 3-methyl-N-[(3-methylpiperidin-3-yl)methyl]triazole-4-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120876257 |
| Molecular Formula | C10H20ClN5O2S |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 3-methyl-N-[(3-methylpiperidin-3-yl)methyl]triazole-4-sulfonamide;hydrochloride |
| SMILES | Cl.Cn1nncc1S(=O)(=O)NCC1(C)CCCNC1 |
| InChI | InChI=1S/C10H19N5O2S.ClH/c1-10(4-3-5-11-7-10)8-13-18(16,17)9-6-12-14-15(9)2;/h6,11,13H,3-5,7-8H2,1-2H3;1H |
| InChIKey | BXPKNEFTNNZIHT-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |