About 1-cyclopentyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride
1-cyclopentyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride (PubChem CID 120876969) has the molecular formula C13H25ClF3N3O2S
and a molecular weight of 379.88 g/mol. Its IUPAC name is 1-cyclopentyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride.
Molecular Properties
| Compound Name | 1-cyclopentyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride |
| PubChem CID | 120876969 |
| Molecular Formula | C13H25ClF3N3O2S |
| Molecular Weight | 379.88 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 1-cyclopentyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(CC1CCCC1)NCC(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C13H24F3N3O2S.ClH/c14-13(15,16)12(19-7-5-17-6-8-19)9-18-22(20,21)10-11-3-1-2-4-11;/h11-12,17-18H,1-10H2;1H |
| InChIKey | RXGRZFFSKMVAGX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.88 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclopentyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride?
The IUPAC name of 1-cyclopentyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride (CID 120876969) is 1-cyclopentyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride.
What is the SMILES notation for 1-cyclopentyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride?
The canonical SMILES for 1-cyclopentyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride is Cl.O=S(=O)(CC1CCCC1)NCC(N1CCNCC1)C(F)(F)F.
What is the InChIKey of 1-cyclopentyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride?
The InChIKey is RXGRZFFSKMVAGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24F3N3O2S.ClH/c14-13(15,16)12(19-7-5-17-6-8-19)9-18-22(20,21)10-11-3-1-2-4-11;/h11-12,17-18H,1-10H2;1H.
What are the key properties of 1-cyclopentyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride?
1-cyclopentyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride has a molecular weight of 379.88 g/mol, XLogP of 1.35, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)methanesulfonamide;hydrochloride is sourced from PubChem (CID 120876969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).