C17H19ClN4OS — CID 120878121
1-benzothiophen-2-yl-[2-(1-methylimidazol-2-yl)piperazin-1-yl]methanone;hydrochloride (PubChem CID 120878121) has the molecular formula C17H19ClN4OS and a molecular weight of 362.89 g/mol. Its IUPAC name is 1-benzothiophen-2-yl-[2-(1-methylimidazol-2-yl)piperazin-1-yl]methanone;hydrochloride.
| Compound Name | 1-benzothiophen-2-yl-[2-(1-methylimidazol-2-yl)piperazin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120878121 |
| Molecular Formula | C17H19ClN4OS |
| Molecular Weight | 362.89 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 1-benzothiophen-2-yl-[2-(1-methylimidazol-2-yl)piperazin-1-yl]methanone;hydrochloride |
| SMILES | Cl.Cn1ccnc1C1CNCCN1C(=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C17H18N4OS.ClH/c1-20-8-7-19-16(20)13-11-18-6-9-21(13)17(22)15-10-12-4-2-3-5-14(12)23-15;/h2-5,7-8,10,13,18H,6,9,11H2,1H3;1H |
| InChIKey | BEXVZNRIVODCSD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.89 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |