C13H21N3O2S — CID 120901836
5-[(6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)methyl]-1,3-thiazol-2-amine (PubChem CID 120901836) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 5-[(6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)methyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[(6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 120901836 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 5-[(6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)methyl]-1,3-thiazol-2-amine |
| SMILES | COC1CCC2OCCN(Cc3cnc(N)s3)C2C1 |
| InChI | InChI=1S/C13H21N3O2S/c1-17-9-2-3-12-11(6-9)16(4-5-18-12)8-10-7-15-13(14)19-10/h7,9,11-12H,2-6,8H2,1H3,(H2,14,15) |
| InChIKey | USGQTTUMOZWMMX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |