C9H14N4O2S — CID 83095925
4-[(2-amino-1,3-thiazol-5-yl)methyl]morpholine-3-carboxamide (PubChem CID 83095925) has the molecular formula C9H14N4O2S and a molecular weight of 242.30 g/mol. Its IUPAC name is 4-[(2-amino-1,3-thiazol-5-yl)methyl]morpholine-3-carboxamide.
| Compound Name | 4-[(2-amino-1,3-thiazol-5-yl)methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83095925 |
| Molecular Formula | C9H14N4O2S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 4-[(2-amino-1,3-thiazol-5-yl)methyl]morpholine-3-carboxamide |
| SMILES | NC(=O)C1COCCN1Cc1cnc(N)s1 |
| InChI | InChI=1S/C9H14N4O2S/c10-8(14)7-5-15-2-1-13(7)4-6-3-12-9(11)16-6/h3,7H,1-2,4-5H2,(H2,10,14)(H2,11,12) |
| InChIKey | FWGYOHZDEUAZPL-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |