C8H14N6O2S — CID 83095661
4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]morpholine-3-carboxamide (PubChem CID 83095661) has the molecular formula C8H14N6O2S and a molecular weight of 258.31 g/mol. Its IUPAC name is 4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]morpholine-3-carboxamide.
| Compound Name | 4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83095661 |
| Molecular Formula | C8H14N6O2S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]morpholine-3-carboxamide |
| SMILES | NNc1nnc(CN2CCOCC2C(N)=O)s1 |
| InChI | InChI=1S/C8H14N6O2S/c9-7(15)5-4-16-2-1-14(5)3-6-12-13-8(11-10)17-6/h5H,1-4,10H2,(H2,9,15)(H,11,13) |
| InChIKey | GEEDUMHLSWZNJV-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|