C8H13N5O2S — CID 83096189
4-[(5-aminothiadiazol-4-yl)methyl]morpholine-3-carboxamide (PubChem CID 83096189) has the molecular formula C8H13N5O2S and a molecular weight of 243.29 g/mol. Its IUPAC name is 4-[(5-aminothiadiazol-4-yl)methyl]morpholine-3-carboxamide.
| Compound Name | 4-[(5-aminothiadiazol-4-yl)methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83096189 |
| Molecular Formula | C8H13N5O2S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 4-[(5-aminothiadiazol-4-yl)methyl]morpholine-3-carboxamide |
| SMILES | NC(=O)C1COCCN1Cc1nnsc1N |
| InChI | InChI=1S/C8H13N5O2S/c9-7(14)6-4-15-2-1-13(6)3-5-8(10)16-12-11-5/h6H,1-4,10H2,(H2,9,14) |
| InChIKey | USALRSDGAQAVES-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |