C17H27NO2 — CID 124775370
(4aR,6R,8aS)-4-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine (PubChem CID 124775370) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is (4aR,6R,8aS)-4-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine.
| Compound Name | (4aR,6R,8aS)-4-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 124775370 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | (4aR,6R,8aS)-4-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
| SMILES | CO[C@@H]1CC[C@@H]2OCCN(C[C@H]3C[C@H]4C=C[C@H]3C4)[C@@H]2C1 |
| InChI | InChI=1S/C17H27NO2/c1-19-15-4-5-17-16(10-15)18(6-7-20-17)11-14-9-12-2-3-13(14)8-12/h2-3,12-17H,4-11H2,1H3/t12-,13-,14+,15+,16+,17-/m0/s1 |
| InChIKey | PTSJCAJPKDAXJJ-PFHJDOJBSA-N |
| XLogP | 2.47 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|