C16H24FN3O2S — CID 120902403
1-(4-fluorophenyl)sulfonyl-4-[(3-methylpyrrolidin-3-yl)methyl]piperazine (PubChem CID 120902403) has the molecular formula C16H24FN3O2S and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-4-[(3-methylpyrrolidin-3-yl)methyl]piperazine.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-4-[(3-methylpyrrolidin-3-yl)methyl]piperazine |
|---|---|
| PubChem CID | 120902403 |
| Molecular Formula | C16H24FN3O2S |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-4-[(3-methylpyrrolidin-3-yl)methyl]piperazine |
| SMILES | CC1(CN2CCN(S(=O)(=O)c3ccc(F)cc3)CC2)CCNC1 |
| InChI | InChI=1S/C16H24FN3O2S/c1-16(6-7-18-12-16)13-19-8-10-20(11-9-19)23(21,22)15-4-2-14(17)3-5-15/h2-5,18H,6-13H2,1H3 |
| InChIKey | BFWWBWSNVZRBAL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |