C14H22ClN3O2S2 — CID 120902495
1-(5-chlorothiophen-2-yl)sulfonyl-4-[(3-methylpyrrolidin-3-yl)methyl]piperazine (PubChem CID 120902495) has the molecular formula C14H22ClN3O2S2 and a molecular weight of 363.94 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-4-[(3-methylpyrrolidin-3-yl)methyl]piperazine.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-4-[(3-methylpyrrolidin-3-yl)methyl]piperazine |
|---|---|
| PubChem CID | 120902495 |
| Molecular Formula | C14H22ClN3O2S2 |
| Molecular Weight | 363.94 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-4-[(3-methylpyrrolidin-3-yl)methyl]piperazine |
| SMILES | CC1(CN2CCN(S(=O)(=O)c3ccc(Cl)s3)CC2)CCNC1 |
| InChI | InChI=1S/C14H22ClN3O2S2/c1-14(4-5-16-10-14)11-17-6-8-18(9-7-17)22(19,20)13-3-2-12(15)21-13/h2-3,16H,4-11H2,1H3 |
| InChIKey | NGEVGIHVDZEYES-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.94 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |