C14H17ClN4O2S2 — CID 120902713
5-[[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-thiazol-2-amine (PubChem CID 120902713) has the molecular formula C14H17ClN4O2S2 and a molecular weight of 372.90 g/mol. Its IUPAC name is 5-[[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 120902713 |
| Molecular Formula | C14H17ClN4O2S2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 5-[[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(CN2CCN(S(=O)(=O)c3ccccc3Cl)CC2)s1 |
| InChI | InChI=1S/C14H17ClN4O2S2/c15-12-3-1-2-4-13(12)23(20,21)19-7-5-18(6-8-19)10-11-9-17-14(16)22-11/h1-4,9H,5-8,10H2,(H2,16,17) |
| InChIKey | PBVQHGNXMCLQQK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |