C14H24ClN5O2 — CID 120904484
1-[(3-methylpyrrolidin-3-yl)methyl]-4-(3-nitropyrazol-1-yl)piperidine;hydrochloride (PubChem CID 120904484) has the molecular formula C14H24ClN5O2 and a molecular weight of 329.83 g/mol. Its IUPAC name is 1-[(3-methylpyrrolidin-3-yl)methyl]-4-(3-nitropyrazol-1-yl)piperidine;hydrochloride.
| Compound Name | 1-[(3-methylpyrrolidin-3-yl)methyl]-4-(3-nitropyrazol-1-yl)piperidine;hydrochloride |
|---|---|
| PubChem CID | 120904484 |
| Molecular Formula | C14H24ClN5O2 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 1-[(3-methylpyrrolidin-3-yl)methyl]-4-(3-nitropyrazol-1-yl)piperidine;hydrochloride |
| SMILES | CC1(CN2CCC(n3ccc([N+](=O)[O-])n3)CC2)CCNC1.Cl |
| InChI | InChI=1S/C14H23N5O2.ClH/c1-14(5-6-15-10-14)11-17-7-2-12(3-8-17)18-9-4-13(16-18)19(20)21;/h4,9,12,15H,2-3,5-8,10-11H2,1H3;1H |
| InChIKey | FQEHBZXKAPVESI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|