C20H29ClN8O6 — CID 160755747
acetyl chloride;4-(3-nitropyrazol-1-yl)piperidine;1-[4-(3-nitropyrazol-1-yl)piperidin-1-yl]ethanone (PubChem CID 160755747) has the molecular formula C20H29ClN8O6 and a molecular weight of 512.96 g/mol. Its IUPAC name is acetyl chloride;4-(3-nitropyrazol-1-yl)piperidine;1-[4-(3-nitropyrazol-1-yl)piperidin-1-yl]ethanone.
| Compound Name | acetyl chloride;4-(3-nitropyrazol-1-yl)piperidine;1-[4-(3-nitropyrazol-1-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 160755747 |
| Molecular Formula | C20H29ClN8O6 |
| Molecular Weight | 512.96 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | acetyl chloride;4-(3-nitropyrazol-1-yl)piperidine;1-[4-(3-nitropyrazol-1-yl)piperidin-1-yl]ethanone |
| SMILES | CC(=O)Cl.CC(=O)N1CCC(n2ccc([N+](=O)[O-])n2)CC1.O=[N+]([O-])c1ccn(C2CCNCC2)n1 |
| InChI | InChI=1S/C10H14N4O3.C8H12N4O2.C2H3ClO/c1-8(15)12-5-2-9(3-6-12)13-7-4-10(11-13)14(16)17;13-12(14)8-3-6-11(10-8)7-1-4-9-5-2-7;1-2(3)4/h4,7,9H,2-3,5-6H2,1H3;3,6-7,9H,1-2,4-5H2;1H3 |
| InChIKey | RXKDNPMGCLQXDW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 171.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.96 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|