About 5-[[4-[2-(3,4-dichlorophenyl)ethyl]piperazin-1-yl]methyl]-1,3-thiazol-2-amine
5-[[4-[2-(3,4-dichlorophenyl)ethyl]piperazin-1-yl]methyl]-1,3-thiazol-2-amine (PubChem CID 120904538) has the molecular formula C16H20Cl2N4S
and a molecular weight of 371.34 g/mol. Its IUPAC name is 5-[[4-[2-(3,4-dichlorophenyl)ethyl]piperazin-1-yl]methyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-[[4-[2-(3,4-dichlorophenyl)ethyl]piperazin-1-yl]methyl]-1,3-thiazol-2-amine |
| PubChem CID | 120904538 |
| Molecular Formula | C16H20Cl2N4S |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 5-[[4-[2-(3,4-dichlorophenyl)ethyl]piperazin-1-yl]methyl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(CN2CCN(CCc3ccc(Cl)c(Cl)c3)CC2)s1 |
| InChI | InChI=1S/C16H20Cl2N4S/c17-14-2-1-12(9-15(14)18)3-4-21-5-7-22(8-6-21)11-13-10-20-16(19)23-13/h1-2,9-10H,3-8,11H2,(H2,19,20) |
| InChIKey | QYBZQWLRICFHAN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[4-[2-(3,4-dichlorophenyl)ethyl]piperazin-1-yl]methyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[4-[2-(3,4-dichlorophenyl)ethyl]piperazin-1-yl]methyl]-1,3-thiazol-2-amine?
The IUPAC name of 5-[[4-[2-(3,4-dichlorophenyl)ethyl]piperazin-1-yl]methyl]-1,3-thiazol-2-amine (CID 120904538) is 5-[[4-[2-(3,4-dichlorophenyl)ethyl]piperazin-1-yl]methyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 5-[[4-[2-(3,4-dichlorophenyl)ethyl]piperazin-1-yl]methyl]-1,3-thiazol-2-amine?
The canonical SMILES for 5-[[4-[2-(3,4-dichlorophenyl)ethyl]piperazin-1-yl]methyl]-1,3-thiazol-2-amine is Nc1ncc(CN2CCN(CCc3ccc(Cl)c(Cl)c3)CC2)s1.
What is the InChIKey of 5-[[4-[2-(3,4-dichlorophenyl)ethyl]piperazin-1-yl]methyl]-1,3-thiazol-2-amine?
The InChIKey is QYBZQWLRICFHAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20Cl2N4S/c17-14-2-1-12(9-15(14)18)3-4-21-5-7-22(8-6-21)11-13-10-20-16(19)23-13/h1-2,9-10H,3-8,11H2,(H2,19,20).
What are the key properties of 5-[[4-[2-(3,4-dichlorophenyl)ethyl]piperazin-1-yl]methyl]-1,3-thiazol-2-amine?
5-[[4-[2-(3,4-dichlorophenyl)ethyl]piperazin-1-yl]methyl]-1,3-thiazol-2-amine has a molecular weight of 371.34 g/mol, XLogP of 3.39, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[4-[2-(3,4-dichlorophenyl)ethyl]piperazin-1-yl]methyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 120904538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).