About 5-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1,3-thiazol-2-amine
5-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1,3-thiazol-2-amine (PubChem CID 120898251) has the molecular formula C13H15Cl2N5S
and a molecular weight of 344.27 g/mol. Its IUPAC name is 5-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1,3-thiazol-2-amine |
| PubChem CID | 120898251 |
| Molecular Formula | C13H15Cl2N5S |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 5-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(CN2CCN(c3ncc(Cl)cc3Cl)CC2)s1 |
| InChI | InChI=1S/C13H15Cl2N5S/c14-9-5-11(15)12(17-6-9)20-3-1-19(2-4-20)8-10-7-18-13(16)21-10/h5-7H,1-4,8H2,(H2,16,18) |
| InChIKey | OSMOIWMECNWEDD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1,3-thiazol-2-amine?
The IUPAC name of 5-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1,3-thiazol-2-amine (CID 120898251) is 5-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 5-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1,3-thiazol-2-amine?
The canonical SMILES for 5-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1,3-thiazol-2-amine is Nc1ncc(CN2CCN(c3ncc(Cl)cc3Cl)CC2)s1.
What is the InChIKey of 5-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1,3-thiazol-2-amine?
The InChIKey is OSMOIWMECNWEDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Cl2N5S/c14-9-5-11(15)12(17-6-9)20-3-1-19(2-4-20)8-10-7-18-13(16)21-10/h5-7H,1-4,8H2,(H2,16,18).
What are the key properties of 5-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1,3-thiazol-2-amine?
5-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1,3-thiazol-2-amine has a molecular weight of 344.27 g/mol, XLogP of 2.75, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 120898251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).