C13H20ClN3O2 — CID 120908981
4-methyl-1-[(2-methyl-4-nitrophenyl)methyl]pyrrolidin-3-amine;hydrochloride (PubChem CID 120908981) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.78 g/mol. Its IUPAC name is 4-methyl-1-[(2-methyl-4-nitrophenyl)methyl]pyrrolidin-3-amine;hydrochloride.
| Compound Name | 4-methyl-1-[(2-methyl-4-nitrophenyl)methyl]pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120908981 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 4-methyl-1-[(2-methyl-4-nitrophenyl)methyl]pyrrolidin-3-amine;hydrochloride |
| SMILES | Cc1cc([N+](=O)[O-])ccc1CN1CC(C)C(N)C1.Cl |
| InChI | InChI=1S/C13H19N3O2.ClH/c1-9-5-12(16(17)18)4-3-11(9)7-15-6-10(2)13(14)8-15;/h3-5,10,13H,6-8,14H2,1-2H3;1H |
| InChIKey | SHQSJYFQWQNVEA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|