C13H21ClN2O3 — CID 120909270
ethyl 5-[(3-amino-4-methylpyrrolidin-1-yl)methyl]furan-2-carboxylate;hydrochloride (PubChem CID 120909270) has the molecular formula C13H21ClN2O3 and a molecular weight of 288.78 g/mol. Its IUPAC name is ethyl 5-[(3-amino-4-methylpyrrolidin-1-yl)methyl]furan-2-carboxylate;hydrochloride.
| Compound Name | ethyl 5-[(3-amino-4-methylpyrrolidin-1-yl)methyl]furan-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 120909270 |
| Molecular Formula | C13H21ClN2O3 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | ethyl 5-[(3-amino-4-methylpyrrolidin-1-yl)methyl]furan-2-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(CN2CC(C)C(N)C2)o1.Cl |
| InChI | InChI=1S/C13H20N2O3.ClH/c1-3-17-13(16)12-5-4-10(18-12)7-15-6-9(2)11(14)8-15;/h4-5,9,11H,3,6-8,14H2,1-2H3;1H |
| InChIKey | KTFICGKSQIOJTM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |