C12H20Cl2N2O3 — CID 167768464
ethyl 5-[(3-aminopyrrolidin-1-yl)methyl]furan-2-carboxylate;dihydrochloride (PubChem CID 167768464) has the molecular formula C12H20Cl2N2O3 and a molecular weight of 311.21 g/mol. Its IUPAC name is ethyl 5-[(3-aminopyrrolidin-1-yl)methyl]furan-2-carboxylate;dihydrochloride.
| Compound Name | ethyl 5-[(3-aminopyrrolidin-1-yl)methyl]furan-2-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 167768464 |
| Molecular Formula | C12H20Cl2N2O3 |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | ethyl 5-[(3-aminopyrrolidin-1-yl)methyl]furan-2-carboxylate;dihydrochloride |
| SMILES | CCOC(=O)c1ccc(CN2CCC(N)C2)o1.Cl.Cl |
| InChI | InChI=1S/C12H18N2O3.2ClH/c1-2-16-12(15)11-4-3-10(17-11)8-14-6-5-9(13)7-14;;/h3-4,9H,2,5-8,13H2,1H3;2*1H |
| InChIKey | IRJXDTSPBXBIIG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |