C14H22BrN3O2 — CID 163463643
ethyl 2-amino-4-[[(3R)-3-aminopyrrolidin-1-yl]methyl]-5-bromocyclohexa-1,3-diene-1-carboxylate (PubChem CID 163463643) has the molecular formula C14H22BrN3O2 and a molecular weight of 344.25 g/mol. Its IUPAC name is ethyl 2-amino-4-[[(3R)-3-aminopyrrolidin-1-yl]methyl]-5-bromocyclohexa-1,3-diene-1-carboxylate.
| Compound Name | ethyl 2-amino-4-[[(3R)-3-aminopyrrolidin-1-yl]methyl]-5-bromocyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 163463643 |
| Molecular Formula | C14H22BrN3O2 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | ethyl 2-amino-4-[[(3R)-3-aminopyrrolidin-1-yl]methyl]-5-bromocyclohexa-1,3-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=C(N)C=C(CN2CC[C@@H](N)C2)C(Br)C1 |
| InChI | InChI=1S/C14H22BrN3O2/c1-2-20-14(19)11-6-12(15)9(5-13(11)17)7-18-4-3-10(16)8-18/h5,10,12H,2-4,6-8,16-17H2,1H3/t10-,12?/m1/s1 |
| InChIKey | BQRLQRWNFHEBTG-RWANSRKNSA-N |
| XLogP | 0.89 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|