C16H29ClN4 — CID 120909798
1-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]-4-methylpyrrolidin-3-amine;hydrochloride (PubChem CID 120909798) has the molecular formula C16H29ClN4 and a molecular weight of 312.89 g/mol. Its IUPAC name is 1-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]-4-methylpyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]-4-methylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120909798 |
| Molecular Formula | C16H29ClN4 |
| Molecular Weight | 312.89 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 1-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]-4-methylpyrrolidin-3-amine;hydrochloride |
| SMILES | CC1CN(Cc2cn(C)nc2C2CCCCC2)CC1N.Cl |
| InChI | InChI=1S/C16H28N4.ClH/c1-12-8-20(11-15(12)17)10-14-9-19(2)18-16(14)13-6-4-3-5-7-13;/h9,12-13,15H,3-8,10-11,17H2,1-2H3;1H |
| InChIKey | VOASUAKUIIZAOH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.89 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |