About 2-[1-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]-3-methoxyazetidin-3-yl]-2,2-difluoroacetic acid
2-[1-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]-3-methoxyazetidin-3-yl]-2,2-difluoroacetic acid (PubChem CID 167773444) has the molecular formula C17H25F2N3O3
and a molecular weight of 357.40 g/mol. Its IUPAC name is 2-[1-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]-3-methoxyazetidin-3-yl]-2,2-difluoroacetic acid.
Molecular Properties
| Compound Name | 2-[1-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]-3-methoxyazetidin-3-yl]-2,2-difluoroacetic acid |
| PubChem CID | 167773444 |
| Molecular Formula | C17H25F2N3O3 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 2-[1-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]-3-methoxyazetidin-3-yl]-2,2-difluoroacetic acid |
| SMILES | COC1(C(F)(F)C(=O)O)CN(Cc2cn(C)nc2C2CCCCC2)C1 |
| InChI | InChI=1S/C17H25F2N3O3/c1-21-8-13(14(20-21)12-6-4-3-5-7-12)9-22-10-16(11-22,25-2)17(18,19)15(23)24/h8,12H,3-7,9-11H2,1-2H3,(H,23,24) |
| InChIKey | ZCUCQCLLIKKDHN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]-3-methoxyazetidin-3-yl]-2,2-difluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]-3-methoxyazetidin-3-yl]-2,2-difluoroacetic acid?
The IUPAC name of 2-[1-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]-3-methoxyazetidin-3-yl]-2,2-difluoroacetic acid (CID 167773444) is 2-[1-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]-3-methoxyazetidin-3-yl]-2,2-difluoroacetic acid.
What is the SMILES notation for 2-[1-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]-3-methoxyazetidin-3-yl]-2,2-difluoroacetic acid?
The canonical SMILES for 2-[1-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]-3-methoxyazetidin-3-yl]-2,2-difluoroacetic acid is COC1(C(F)(F)C(=O)O)CN(Cc2cn(C)nc2C2CCCCC2)C1.
What is the InChIKey of 2-[1-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]-3-methoxyazetidin-3-yl]-2,2-difluoroacetic acid?
The InChIKey is ZCUCQCLLIKKDHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25F2N3O3/c1-21-8-13(14(20-21)12-6-4-3-5-7-12)9-22-10-16(11-22,25-2)17(18,19)15(23)24/h8,12H,3-7,9-11H2,1-2H3,(H,23,24).
What are the key properties of 2-[1-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]-3-methoxyazetidin-3-yl]-2,2-difluoroacetic acid?
2-[1-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]-3-methoxyazetidin-3-yl]-2,2-difluoroacetic acid has a molecular weight of 357.40 g/mol, XLogP of 2.39, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]-3-methoxyazetidin-3-yl]-2,2-difluoroacetic acid is sourced from PubChem (CID 167773444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).