C21H29N3O2 — CID 126788027
3-[4-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]morpholin-2-yl]phenol (PubChem CID 126788027) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 3-[4-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]morpholin-2-yl]phenol.
| Compound Name | 3-[4-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]morpholin-2-yl]phenol |
|---|---|
| PubChem CID | 126788027 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 3-[4-[(3-cyclohexyl-1-methylpyrazol-4-yl)methyl]morpholin-2-yl]phenol |
| SMILES | Cn1cc(CN2CCOC(c3cccc(O)c3)C2)c(C2CCCCC2)n1 |
| InChI | InChI=1S/C21H29N3O2/c1-23-13-18(21(22-23)16-6-3-2-4-7-16)14-24-10-11-26-20(15-24)17-8-5-9-19(25)12-17/h5,8-9,12-13,16,20,25H,2-4,6-7,10-11,14-15H2,1H3 |
| InChIKey | BNAVDPWLCZIHHF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |