C18H25N3O3 — CID 120920419
1-[(2R,3S)-2-methylmorpholine-3-carbonyl]-N-phenylpiperidine-3-carboxamide (PubChem CID 120920419) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-[(2R,3S)-2-methylmorpholine-3-carbonyl]-N-phenylpiperidine-3-carboxamide.
| Compound Name | 1-[(2R,3S)-2-methylmorpholine-3-carbonyl]-N-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 120920419 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-[(2R,3S)-2-methylmorpholine-3-carbonyl]-N-phenylpiperidine-3-carboxamide |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)N1CCCC(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C18H25N3O3/c1-13-16(19-9-11-24-13)18(23)21-10-5-6-14(12-21)17(22)20-15-7-3-2-4-8-15/h2-4,7-8,13-14,16,19H,5-6,9-12H2,1H3,(H,20,22)/t13-,14?,16+/m1/s1 |
| InChIKey | NRAFWIUQYAINCY-XIFZVWCKSA-N |
| XLogP | 1.24 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |