About [(3S,4R)-1-(1-phenyltetrazol-5-yl)-4-(1-propan-2-ylpyrazol-4-yl)pyrrolidin-3-yl]methanol
[(3S,4R)-1-(1-phenyltetrazol-5-yl)-4-(1-propan-2-ylpyrazol-4-yl)pyrrolidin-3-yl]methanol (PubChem CID 120929923) has the molecular formula C18H23N7O
and a molecular weight of 353.43 g/mol. Its IUPAC name is [(3S,4R)-1-(1-phenyltetrazol-5-yl)-4-(1-propan-2-ylpyrazol-4-yl)pyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S,4R)-1-(1-phenyltetrazol-5-yl)-4-(1-propan-2-ylpyrazol-4-yl)pyrrolidin-3-yl]methanol |
| PubChem CID | 120929923 |
| Molecular Formula | C18H23N7O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | [(3S,4R)-1-(1-phenyltetrazol-5-yl)-4-(1-propan-2-ylpyrazol-4-yl)pyrrolidin-3-yl]methanol |
| SMILES | CC(C)n1cc([C@@H]2CN(c3nnnn3-c3ccccc3)C[C@H]2CO)cn1 |
| InChI | InChI=1S/C18H23N7O/c1-13(2)24-10-14(8-19-24)17-11-23(9-15(17)12-26)18-20-21-22-25(18)16-6-4-3-5-7-16/h3-8,10,13,15,17,26H,9,11-12H2,1-2H3/t15-,17-/m0/s1 |
| InChIKey | BSUCGZSACDANIZ-RDJZCZTQSA-N |
| XLogP | 1.65 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [(3S,4R)-1-(1-phenyltetrazol-5-yl)-4-(1-propan-2-ylpyrazol-4-yl)pyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-1-(1-phenyltetrazol-5-yl)-4-(1-propan-2-ylpyrazol-4-yl)pyrrolidin-3-yl]methanol?
The IUPAC name of [(3S,4R)-1-(1-phenyltetrazol-5-yl)-4-(1-propan-2-ylpyrazol-4-yl)pyrrolidin-3-yl]methanol (CID 120929923) is [(3S,4R)-1-(1-phenyltetrazol-5-yl)-4-(1-propan-2-ylpyrazol-4-yl)pyrrolidin-3-yl]methanol.
What is the SMILES notation for [(3S,4R)-1-(1-phenyltetrazol-5-yl)-4-(1-propan-2-ylpyrazol-4-yl)pyrrolidin-3-yl]methanol?
The canonical SMILES for [(3S,4R)-1-(1-phenyltetrazol-5-yl)-4-(1-propan-2-ylpyrazol-4-yl)pyrrolidin-3-yl]methanol is CC(C)n1cc([C@@H]2CN(c3nnnn3-c3ccccc3)C[C@H]2CO)cn1.
What is the InChIKey of [(3S,4R)-1-(1-phenyltetrazol-5-yl)-4-(1-propan-2-ylpyrazol-4-yl)pyrrolidin-3-yl]methanol?
The InChIKey is BSUCGZSACDANIZ-RDJZCZTQSA-N. The full InChI is InChI=1S/C18H23N7O/c1-13(2)24-10-14(8-19-24)17-11-23(9-15(17)12-26)18-20-21-22-25(18)16-6-4-3-5-7-16/h3-8,10,13,15,17,26H,9,11-12H2,1-2H3/t15-,17-/m0/s1.
What are the key properties of [(3S,4R)-1-(1-phenyltetrazol-5-yl)-4-(1-propan-2-ylpyrazol-4-yl)pyrrolidin-3-yl]methanol?
[(3S,4R)-1-(1-phenyltetrazol-5-yl)-4-(1-propan-2-ylpyrazol-4-yl)pyrrolidin-3-yl]methanol has a molecular weight of 353.43 g/mol, XLogP of 1.65, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-1-(1-phenyltetrazol-5-yl)-4-(1-propan-2-ylpyrazol-4-yl)pyrrolidin-3-yl]methanol is sourced from PubChem (CID 120929923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).