C17H22ClN3O4 — CID 120932574
(2R,3S)-N-[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl]-2-methylmorpholine-3-carboxamide;hydrochloride (PubChem CID 120932574) has the molecular formula C17H22ClN3O4 and a molecular weight of 367.83 g/mol. Its IUPAC name is (2R,3S)-N-[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl]-2-methylmorpholine-3-carboxamide;hydrochloride.
| Compound Name | (2R,3S)-N-[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl]-2-methylmorpholine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120932574 |
| Molecular Formula | C17H22ClN3O4 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | (2R,3S)-N-[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl]-2-methylmorpholine-3-carboxamide;hydrochloride |
| SMILES | Cc1cc(NC(=O)[C@H]2NCCO[C@@H]2C)ccc1N1C(=O)CCC1=O.Cl |
| InChI | InChI=1S/C17H21N3O4.ClH/c1-10-9-12(19-17(23)16-11(2)24-8-7-18-16)3-4-13(10)20-14(21)5-6-15(20)22;/h3-4,9,11,16,18H,5-8H2,1-2H3,(H,19,23);1H/t11-,16+;/m1./s1 |
| InChIKey | LHJXZNJZRVGQDQ-VAGBGMFXSA-N |
| XLogP | 1.39 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|