C20H27Cl2N3O3 — CID 120939703
4-(aminomethyl)-N-[6-(3-ethylphenoxy)-3-pyridinyl]oxane-4-carboxamide;dihydrochloride (PubChem CID 120939703) has the molecular formula C20H27Cl2N3O3 and a molecular weight of 428.36 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[6-(3-ethylphenoxy)-3-pyridinyl]oxane-4-carboxamide;dihydrochloride.
| Compound Name | 4-(aminomethyl)-N-[6-(3-ethylphenoxy)-3-pyridinyl]oxane-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120939703 |
| Molecular Formula | C20H27Cl2N3O3 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 4-(aminomethyl)-N-[6-(3-ethylphenoxy)-3-pyridinyl]oxane-4-carboxamide;dihydrochloride |
| SMILES | CCc1cccc(Oc2ccc(NC(=O)C3(CN)CCOCC3)cn2)c1.Cl.Cl |
| InChI | InChI=1S/C20H25N3O3.2ClH/c1-2-15-4-3-5-17(12-15)26-18-7-6-16(13-22-18)23-19(24)20(14-21)8-10-25-11-9-20;;/h3-7,12-13H,2,8-11,14,21H2,1H3,(H,23,24);2*1H |
| InChIKey | LNHDTUXWBUYQCL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |