C17H33N3O3 — CID 120941475
4-(aminomethyl)-N-[2-(4-methoxypiperidin-1-yl)-2-methylpropyl]oxane-4-carboxamide (PubChem CID 120941475) has the molecular formula C17H33N3O3 and a molecular weight of 327.47 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[2-(4-methoxypiperidin-1-yl)-2-methylpropyl]oxane-4-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[2-(4-methoxypiperidin-1-yl)-2-methylpropyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 120941475 |
| Molecular Formula | C17H33N3O3 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.25 |
| IUPAC Name | 4-(aminomethyl)-N-[2-(4-methoxypiperidin-1-yl)-2-methylpropyl]oxane-4-carboxamide |
| SMILES | COC1CCN(C(C)(C)CNC(=O)C2(CN)CCOCC2)CC1 |
| InChI | InChI=1S/C17H33N3O3/c1-16(2,20-8-4-14(22-3)5-9-20)13-19-15(21)17(12-18)6-10-23-11-7-17/h14H,4-13,18H2,1-3H3,(H,19,21) |
| InChIKey | BNACAFZLAQPMQL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |