C14H19F3N2O3 — CID 120953930
(3S,4S)-1-[2-[bis(prop-2-enyl)amino]-2-oxoethyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 120953930) has the molecular formula C14H19F3N2O3 and a molecular weight of 320.31 g/mol. Its IUPAC name is (3S,4S)-1-[2-[bis(prop-2-enyl)amino]-2-oxoethyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-[2-[bis(prop-2-enyl)amino]-2-oxoethyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120953930 |
| Molecular Formula | C14H19F3N2O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (3S,4S)-1-[2-[bis(prop-2-enyl)amino]-2-oxoethyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | C=CCN(CC=C)C(=O)CN1C[C@@H](C(F)(F)F)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C14H19F3N2O3/c1-3-5-19(6-4-2)12(20)9-18-7-10(13(21)22)11(8-18)14(15,16)17/h3-4,10-11H,1-2,5-9H2,(H,21,22)/t10-,11-/m1/s1 |
| InChIKey | BHUPOGLVDOWQFO-GHMZBOCLSA-N |
| XLogP | 1.38 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|