C13H15BrClN5O3 — CID 120961518
5-(2-bromo-4-nitrophenyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole;hydrochloride (PubChem CID 120961518) has the molecular formula C13H15BrClN5O3 and a molecular weight of 404.65 g/mol. Its IUPAC name is 5-(2-bromo-4-nitrophenyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole;hydrochloride.
| Compound Name | 5-(2-bromo-4-nitrophenyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole;hydrochloride |
|---|---|
| PubChem CID | 120961518 |
| Molecular Formula | C13H15BrClN5O3 |
| Molecular Weight | 404.65 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 5-(2-bromo-4-nitrophenyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole;hydrochloride |
| SMILES | CN1CCNCC1c1noc(-c2ccc([N+](=O)[O-])cc2Br)n1.Cl |
| InChI | InChI=1S/C13H14BrN5O3.ClH/c1-18-5-4-15-7-11(18)12-16-13(22-17-12)9-3-2-8(19(20)21)6-10(9)14;/h2-3,6,11,15H,4-5,7H2,1H3;1H |
| InChIKey | NUVXZWRAPNRCKS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.65 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|