C16H21ClN6O4 — CID 120959628
N-[1-[3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazol-5-yl]ethyl]-3-nitrobenzamide;hydrochloride (PubChem CID 120959628) has the molecular formula C16H21ClN6O4 and a molecular weight of 396.84 g/mol. Its IUPAC name is N-[1-[3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazol-5-yl]ethyl]-3-nitrobenzamide;hydrochloride.
| Compound Name | N-[1-[3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazol-5-yl]ethyl]-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 120959628 |
| Molecular Formula | C16H21ClN6O4 |
| Molecular Weight | 396.84 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N-[1-[3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazol-5-yl]ethyl]-3-nitrobenzamide;hydrochloride |
| SMILES | CC(NC(=O)c1cccc([N+](=O)[O-])c1)c1nc(C2CNCCN2C)no1.Cl |
| InChI | InChI=1S/C16H20N6O4.ClH/c1-10(18-15(23)11-4-3-5-12(8-11)22(24)25)16-19-14(20-26-16)13-9-17-6-7-21(13)2;/h3-5,8,10,13,17H,6-7,9H2,1-2H3,(H,18,23);1H |
| InChIKey | LBFWPTCWCJCCGZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.84 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|