C14H17N5O3 — CID 120957256
3-(1-methylpiperazin-2-yl)-5-[(3-nitrophenyl)methyl]-1,2,4-oxadiazole (PubChem CID 120957256) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is 3-(1-methylpiperazin-2-yl)-5-[(3-nitrophenyl)methyl]-1,2,4-oxadiazole.
| Compound Name | 3-(1-methylpiperazin-2-yl)-5-[(3-nitrophenyl)methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 120957256 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 3-(1-methylpiperazin-2-yl)-5-[(3-nitrophenyl)methyl]-1,2,4-oxadiazole |
| SMILES | CN1CCNCC1c1noc(Cc2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C14H17N5O3/c1-18-6-5-15-9-12(18)14-16-13(22-17-14)8-10-3-2-4-11(7-10)19(20)21/h2-4,7,12,15H,5-6,8-9H2,1H3 |
| InChIKey | PMACNVHCGYGAIU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|