C15H21ClN6O5S — CID 120957693
N-methyl-N-[[3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-3-nitrobenzenesulfonamide;hydrochloride (PubChem CID 120957693) has the molecular formula C15H21ClN6O5S and a molecular weight of 432.89 g/mol. Its IUPAC name is N-methyl-N-[[3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-3-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-methyl-N-[[3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-3-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120957693 |
| Molecular Formula | C15H21ClN6O5S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-methyl-N-[[3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-3-nitrobenzenesulfonamide;hydrochloride |
| SMILES | CN1CCNCC1c1noc(CN(C)S(=O)(=O)c2cccc([N+](=O)[O-])c2)n1.Cl |
| InChI | InChI=1S/C15H20N6O5S.ClH/c1-19-7-6-16-9-13(19)15-17-14(26-18-15)10-20(2)27(24,25)12-5-3-4-11(8-12)21(22)23;/h3-5,8,13,16H,6-7,9-10H2,1-2H3;1H |
| InChIKey | WBXADLXDBIWGFA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|