C18H25ClN4O — CID 120962078
4-[[[6-(N-methylanilino)-3-pyridinyl]methylamino]methyl]pyrrolidin-3-ol;hydrochloride (PubChem CID 120962078) has the molecular formula C18H25ClN4O and a molecular weight of 348.88 g/mol. Its IUPAC name is 4-[[[6-(N-methylanilino)-3-pyridinyl]methylamino]methyl]pyrrolidin-3-ol;hydrochloride.
| Compound Name | 4-[[[6-(N-methylanilino)-3-pyridinyl]methylamino]methyl]pyrrolidin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 120962078 |
| Molecular Formula | C18H25ClN4O |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 4-[[[6-(N-methylanilino)-3-pyridinyl]methylamino]methyl]pyrrolidin-3-ol;hydrochloride |
| SMILES | CN(c1ccccc1)c1ccc(CNCC2CNCC2O)cn1.Cl |
| InChI | InChI=1S/C18H24N4O.ClH/c1-22(16-5-3-2-4-6-16)18-8-7-14(10-21-18)9-19-11-15-12-20-13-17(15)23;/h2-8,10,15,17,19-20,23H,9,11-13H2,1H3;1H |
| InChIKey | XNMRGKGZXAIELY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |