C16H19ClFN3O3 — CID 120963816
(3aR,7aS)-5-(3-chloro-5-fluorobenzoyl)-1-(2-methoxyethyl)-3,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one (PubChem CID 120963816) has the molecular formula C16H19ClFN3O3 and a molecular weight of 355.80 g/mol. Its IUPAC name is (3aR,7aS)-5-(3-chloro-5-fluorobenzoyl)-1-(2-methoxyethyl)-3,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one.
| Compound Name | (3aR,7aS)-5-(3-chloro-5-fluorobenzoyl)-1-(2-methoxyethyl)-3,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 120963816 |
| Molecular Formula | C16H19ClFN3O3 |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (3aR,7aS)-5-(3-chloro-5-fluorobenzoyl)-1-(2-methoxyethyl)-3,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one |
| SMILES | COCCN1C(=O)N[C@@H]2CN(C(=O)c3cc(F)cc(Cl)c3)CC[C@@H]21 |
| InChI | InChI=1S/C16H19ClFN3O3/c1-24-5-4-21-14-2-3-20(9-13(14)19-16(21)23)15(22)10-6-11(17)8-12(18)7-10/h6-8,13-14H,2-5,9H2,1H3,(H,19,23)/t13-,14+/m1/s1 |
| InChIKey | WNCWOWNZLWUFHZ-KGLIPLIRSA-N |
| XLogP | 1.73 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |