C15H17ClFN3O2 — CID 120963737
(3aR,7aS)-5-[2-(2-chloro-4-fluorophenyl)acetyl]-1-methyl-3,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one (PubChem CID 120963737) has the molecular formula C15H17ClFN3O2 and a molecular weight of 325.77 g/mol. Its IUPAC name is (3aR,7aS)-5-[2-(2-chloro-4-fluorophenyl)acetyl]-1-methyl-3,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one.
| Compound Name | (3aR,7aS)-5-[2-(2-chloro-4-fluorophenyl)acetyl]-1-methyl-3,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 120963737 |
| Molecular Formula | C15H17ClFN3O2 |
| Molecular Weight | 325.77 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (3aR,7aS)-5-[2-(2-chloro-4-fluorophenyl)acetyl]-1-methyl-3,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-one |
| SMILES | CN1C(=O)N[C@@H]2CN(C(=O)Cc3ccc(F)cc3Cl)CC[C@@H]21 |
| InChI | InChI=1S/C15H17ClFN3O2/c1-19-13-4-5-20(8-12(13)18-15(19)22)14(21)6-9-2-3-10(17)7-11(9)16/h2-3,7,12-13H,4-6,8H2,1H3,(H,18,22)/t12-,13+/m1/s1 |
| InChIKey | NSRFUHHPAVZEGE-OLZOCXBDSA-N |
| XLogP | 1.65 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.77 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |