C15H18ClFN2O — CID 99819047
1-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-(2-chloro-4-fluorophenyl)ethanone (PubChem CID 99819047) has the molecular formula C15H18ClFN2O and a molecular weight of 296.77 g/mol. Its IUPAC name is 1-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-(2-chloro-4-fluorophenyl)ethanone.
| Compound Name | 1-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-(2-chloro-4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 99819047 |
| Molecular Formula | C15H18ClFN2O |
| Molecular Weight | 296.77 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 1-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-(2-chloro-4-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(F)cc1Cl)N1CCN2CCC[C@H]2C1 |
| InChI | InChI=1S/C15H18ClFN2O/c16-14-9-12(17)4-3-11(14)8-15(20)19-7-6-18-5-1-2-13(18)10-19/h3-4,9,13H,1-2,5-8,10H2/t13-/m0/s1 |
| InChIKey | UTZUUGVVVWJEIX-ZDUSSCGKSA-N |
| XLogP | 2.33 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.77 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |