C14H18F2N2 — CID 120966791
9-[(2,6-difluorophenyl)methyl]-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 120966791) has the molecular formula C14H18F2N2 and a molecular weight of 252.31 g/mol. Its IUPAC name is 9-[(2,6-difluorophenyl)methyl]-3,9-diazabicyclo[4.2.1]nonane.
| Compound Name | 9-[(2,6-difluorophenyl)methyl]-3,9-diazabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 120966791 |
| Molecular Formula | C14H18F2N2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 9-[(2,6-difluorophenyl)methyl]-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | Fc1cccc(F)c1CN1C2CCNCC1CC2 |
| InChI | InChI=1S/C14H18F2N2/c15-13-2-1-3-14(16)12(13)9-18-10-4-5-11(18)8-17-7-6-10/h1-3,10-11,17H,4-9H2 |
| InChIKey | ZMDLQPDGQRQBOK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |