About 3-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]thiolan-3-ol;hydroiodide
3-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]thiolan-3-ol;hydroiodide (PubChem CID 120970944) has the molecular formula C9H18IN3OS
and a molecular weight of 343.23 g/mol. Its IUPAC name is 3-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]thiolan-3-ol;hydroiodide.
Molecular Properties
| Compound Name | 3-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]thiolan-3-ol;hydroiodide |
| PubChem CID | 120970944 |
| Molecular Formula | C9H18IN3OS |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 3-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]thiolan-3-ol;hydroiodide |
| SMILES | CC1CN=C(NCC2(O)CCSC2)N1.I |
| InChI | InChI=1S/C9H17N3OS.HI/c1-7-4-10-8(12-7)11-5-9(13)2-3-14-6-9;/h7,13H,2-6H2,1H3,(H2,10,11,12);1H |
| InChIKey | RONLFNICAXSTHW-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]thiolan-3-ol;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]thiolan-3-ol;hydroiodide?
The IUPAC name of 3-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]thiolan-3-ol;hydroiodide (CID 120970944) is 3-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]thiolan-3-ol;hydroiodide.
What is the SMILES notation for 3-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]thiolan-3-ol;hydroiodide?
The canonical SMILES for 3-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]thiolan-3-ol;hydroiodide is CC1CN=C(NCC2(O)CCSC2)N1.I.
What is the InChIKey of 3-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]thiolan-3-ol;hydroiodide?
The InChIKey is RONLFNICAXSTHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3OS.HI/c1-7-4-10-8(12-7)11-5-9(13)2-3-14-6-9;/h7,13H,2-6H2,1H3,(H2,10,11,12);1H.
What are the key properties of 3-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]thiolan-3-ol;hydroiodide?
3-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]thiolan-3-ol;hydroiodide has a molecular weight of 343.23 g/mol, XLogP of 0.41, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]thiolan-3-ol;hydroiodide is sourced from PubChem (CID 120970944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).