C10H20N4O — CID 120969175
2-methyl-N-[2-[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]ethyl]propanamide (PubChem CID 120969175) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is 2-methyl-N-[2-[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 120969175 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 2-methyl-N-[2-[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]ethyl]propanamide |
| SMILES | CC1CN=C(NCCNC(=O)C(C)C)N1 |
| InChI | InChI=1S/C10H20N4O/c1-7(2)9(15)11-4-5-12-10-13-6-8(3)14-10/h7-8H,4-6H2,1-3H3,(H,11,15)(H2,12,13,14) |
| InChIKey | IRBKIVXATJVELY-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|