C17H20N2O6S — CID 120978678
(3R,4R)-4-cyclopropyl-1-(4-methoxy-5-methylsulfanyl-2-nitrobenzoyl)pyrrolidine-3-carboxylic acid (PubChem CID 120978678) has the molecular formula C17H20N2O6S and a molecular weight of 380.42 g/mol. Its IUPAC name is (3R,4R)-4-cyclopropyl-1-(4-methoxy-5-methylsulfanyl-2-nitrobenzoyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-cyclopropyl-1-(4-methoxy-5-methylsulfanyl-2-nitrobenzoyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120978678 |
| Molecular Formula | C17H20N2O6S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | (3R,4R)-4-cyclopropyl-1-(4-methoxy-5-methylsulfanyl-2-nitrobenzoyl)pyrrolidine-3-carboxylic acid |
| SMILES | COc1cc([N+](=O)[O-])c(C(=O)N2C[C@H](C(=O)O)[C@@H](C3CC3)C2)cc1SC |
| InChI | InChI=1S/C17H20N2O6S/c1-25-14-6-13(19(23)24)10(5-15(14)26-2)16(20)18-7-11(9-3-4-9)12(8-18)17(21)22/h5-6,9,11-12H,3-4,7-8H2,1-2H3,(H,21,22)/t11-,12+/m1/s1 |
| InChIKey | OTNYAKUREBWHMJ-NEPJUHHUSA-N |
| XLogP | 2.51 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|