C16H18N2O5S — CID 120980019
(3R,4R)-4-cyclopropyl-1-(4-methylsulfanyl-3-nitrobenzoyl)pyrrolidine-3-carboxylic acid (PubChem CID 120980019) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is (3R,4R)-4-cyclopropyl-1-(4-methylsulfanyl-3-nitrobenzoyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-cyclopropyl-1-(4-methylsulfanyl-3-nitrobenzoyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120980019 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | (3R,4R)-4-cyclopropyl-1-(4-methylsulfanyl-3-nitrobenzoyl)pyrrolidine-3-carboxylic acid |
| SMILES | CSc1ccc(C(=O)N2C[C@H](C(=O)O)[C@@H](C3CC3)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18N2O5S/c1-24-14-5-4-10(6-13(14)18(22)23)15(19)17-7-11(9-2-3-9)12(8-17)16(20)21/h4-6,9,11-12H,2-3,7-8H2,1H3,(H,20,21)/t11-,12+/m1/s1 |
| InChIKey | RIWBHOSYKPTTTB-NEPJUHHUSA-N |
| XLogP | 2.50 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|