C18H34ClN3O — CID 120981286
3-[2-(cyclohexylmethyl)pyrrolidin-1-yl]-1-piperazin-1-ylpropan-1-one;hydrochloride (PubChem CID 120981286) has the molecular formula C18H34ClN3O and a molecular weight of 343.94 g/mol. Its IUPAC name is 3-[2-(cyclohexylmethyl)pyrrolidin-1-yl]-1-piperazin-1-ylpropan-1-one;hydrochloride.
| Compound Name | 3-[2-(cyclohexylmethyl)pyrrolidin-1-yl]-1-piperazin-1-ylpropan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120981286 |
| Molecular Formula | C18H34ClN3O |
| Molecular Weight | 343.94 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | 3-[2-(cyclohexylmethyl)pyrrolidin-1-yl]-1-piperazin-1-ylpropan-1-one;hydrochloride |
| SMILES | Cl.O=C(CCN1CCCC1CC1CCCCC1)N1CCNCC1 |
| InChI | InChI=1S/C18H33N3O.ClH/c22-18(21-13-9-19-10-14-21)8-12-20-11-4-7-17(20)15-16-5-2-1-3-6-16;/h16-17,19H,1-15H2;1H |
| InChIKey | YOCFBMMPXNLSLN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.94 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |