C19H29ClN4O3 — CID 120981373
N-(4-hydroxyphenyl)-1-(3-oxo-3-piperazin-1-ylpropyl)piperidine-4-carboxamide;hydrochloride (PubChem CID 120981373) has the molecular formula C19H29ClN4O3 and a molecular weight of 396.92 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-1-(3-oxo-3-piperazin-1-ylpropyl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | N-(4-hydroxyphenyl)-1-(3-oxo-3-piperazin-1-ylpropyl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120981373 |
| Molecular Formula | C19H29ClN4O3 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | N-(4-hydroxyphenyl)-1-(3-oxo-3-piperazin-1-ylpropyl)piperidine-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc(O)cc1)C1CCN(CCC(=O)N2CCNCC2)CC1 |
| InChI | InChI=1S/C19H28N4O3.ClH/c24-17-3-1-16(2-4-17)21-19(26)15-5-10-22(11-6-15)12-7-18(25)23-13-8-20-9-14-23;/h1-4,15,20,24H,5-14H2,(H,21,26);1H |
| InChIKey | ZYYURWFYAVQAEH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|