C17H32N4O2 — CID 120982532
3-[4-(2-methylmorpholin-4-yl)piperidin-1-yl]-1-piperazin-1-ylpropan-1-one (PubChem CID 120982532) has the molecular formula C17H32N4O2 and a molecular weight of 324.47 g/mol. Its IUPAC name is 3-[4-(2-methylmorpholin-4-yl)piperidin-1-yl]-1-piperazin-1-ylpropan-1-one.
| Compound Name | 3-[4-(2-methylmorpholin-4-yl)piperidin-1-yl]-1-piperazin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 120982532 |
| Molecular Formula | C17H32N4O2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 3-[4-(2-methylmorpholin-4-yl)piperidin-1-yl]-1-piperazin-1-ylpropan-1-one |
| SMILES | CC1CN(C2CCN(CCC(=O)N3CCNCC3)CC2)CCO1 |
| InChI | InChI=1S/C17H32N4O2/c1-15-14-21(12-13-23-15)16-2-7-19(8-3-16)9-4-17(22)20-10-5-18-6-11-20/h15-16,18H,2-14H2,1H3 |
| InChIKey | HVZPDCMICOZFDI-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |