C25H32N2O2 — CID 60558230
1-[4-(2-methylmorpholin-4-yl)piperidin-1-yl]-3,3-diphenylpropan-1-one (PubChem CID 60558230) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is 1-[4-(2-methylmorpholin-4-yl)piperidin-1-yl]-3,3-diphenylpropan-1-one.
| Compound Name | 1-[4-(2-methylmorpholin-4-yl)piperidin-1-yl]-3,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 60558230 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 1-[4-(2-methylmorpholin-4-yl)piperidin-1-yl]-3,3-diphenylpropan-1-one |
| SMILES | CC1CN(C2CCN(C(=O)CC(c3ccccc3)c3ccccc3)CC2)CCO1 |
| InChI | InChI=1S/C25H32N2O2/c1-20-19-27(16-17-29-20)23-12-14-26(15-13-23)25(28)18-24(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-11,20,23-24H,12-19H2,1H3 |
| InChIKey | YPZZZPUHSLXRFE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |